CONTACT US
 

 TEL: 86-0512-63009836
 FAX: 86-0512-63006936
 QQ: 1933702730 1827891490

 
      PRODUCT SEARCH
    Chemicals Search
 

 
    Popular Products



      Recommended Products
 



 
N-benzyl-5-(trifluoromethyl)-1H-pyrazol-3-amine898540-03-9  



 
CINNOLIN-4(1H)-ONE18514-84-6  



 
4-(1-Pyrrolidino)benzaldehyde51980-54-2  
Product Information
Compound: 4-Fluoro-3-methoxybenzyl bromide

Cas NO.: 141080-73-1
Catalog NO.: SC-82732
Leadtime:
Purity: 98%

MF:C8H8BrFO
MW: 219.051
MDL: MFCD04972878

 
Email  
Name      *
Company     
Country     
Quantity      *
Remark